product summary
Loading...
company name :
StressMarq Biosciences
product type :
chemical
product name :
KT5720
catalog :
SIH-457-100UG
quantity :
100 µg
price :
128 USD
more info or order :
product information
Catalog No :
SIH-457-100UG
Product Name :
KT5720
Category :
Small Molecules
Product Type :
Inhibitor
Size :
100 µg
List Price USD :
128 USD
Description :
PKA kinase inhibitor
Alternative Name(s) :
(9S,10S,12R)-2,3,9,10,11,12-Hexahydro-10-hydroxy-9-methyl-1-oxo-9,12-epoxy-1H-diindolo[1,2,3-fg:3′,2′,1′-kl]pyrrolo[3,4-i][1,6]benzodiazocine-10-carboxylic acid hexyl ester
CAS No :
108068-98-0
MolecularFormula :
C32H31N3O5
Molecular Weight :
537.6
Source :
Synthetic
Purity :
≥98% (TLC)
SMILES :
[N]47C1=C(C6=C(C2=C1[N](C3=CC=CC=C23)[C@H]5O[C@@]4([C@](C5)(O)C(=O)OCCCCCC)C)C(NC6)=O)C8=C7C=CC=C8
InChI :
InChI=1S/C32H31N3O5/c1-3-4-5-10-15-39-30(37)32(38)16-23-34-21-13-8-6-11-18(21)25-26-20(17-33-29(26)36)24-19-12-7-9-14-22(19)35(28(24)27(25)34)31(32,2)40-23/h6-9,11-14,23,38H,3-5,10,15-17H2,1-2H3,(H,33,36)
InChIKey :
ZHEHVZXPFVXKEY-UHFFFAOYSA-N
SD File :
C32H31N3O5
APtclcactv07301412562D 0 0.00000 0.00000
71 78 0 0 1 0 0 0 0 0999 V2000
6.8258 -0.4438 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.8258 1.2882 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.4507 1.8881 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0
8.1919 0.9222 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0
10.0238 0.1634 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0
7.8859 -1.9127 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9143 -2.9475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0281 -3.4826 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1255 -2.9758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2829 1.9477 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2953 2.9828 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2018 3.4826 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0838 2.9407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6599 -0.0623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4689 0.5255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3825 0.1187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1915 0.7065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1050 0.2998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9141 0.8876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9330 -0.0437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1000 -2.0176 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
9.3529 -1.0833 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
2.0000 -0.0099 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.0419 -1.2379 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.5825 -2.1296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9193 -0.8312 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.9374 -0.2434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7464 0.3444 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.7443 -0.6777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7566 -0.4598 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2774 -1.3619 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2826 1.1293 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6370 -1.7076 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.0475 1.9061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1772 1.4263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2843 0.4382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3190 -1.3538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1211 -1.9406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9718 -1.4269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7141 2.8707 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.8258 -0.4438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3258 0.4222 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6707 2.7091 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
8.4129 -1.5861 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
8.4584 -3.2448 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
7.0380 -4.1026 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
5.5911 -3.2902 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
3.2718 -2.6661 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
4.0834 -2.4950 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
2.7435 1.6421 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
2.7634 3.3013 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
4.2164 4.1025 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
5.6302 3.2338 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
10.8739 0.9428 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
10.4947 1.7119 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
12.3132 -0.5763 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
13.1059 -0.4930 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
13.8156 1.0395 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
13.0229 0.9561 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
14.0358 -0.3953 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
14.8285 -0.3120 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
15.5382 1.2205 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
14.7455 1.1372 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
15.7583 -0.2142 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
16.5510 -0.1309 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
17.2785 0.3860 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
17.4157 1.2520 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
16.5496 1.3891 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
7.3342 0.1167 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
7.7726 -0.6426 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
8.5319 -0.2042 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
1 41 1 0 0 0 0
1 39 1 0 0 0 0
1 4 1 0 0 0 0
41 42 1 0 0 0 0
37 41 2 0 0 0 0
2 42 1 0 0 0 0
36 42 2 0 0 0 0
2 34 1 0 0 0 0
2 3 1 0 0 0 0
34 35 1 0 0 0 0
13 34 2 0 0 0 0
35 36 1 0 0 0 0
10 35 2 0 0 0 0
30 36 1 0 0 0 0
30 31 2 0 0 0 0
29 30 1 0 0 0 0
31 37 1 0 0 0 0
25 31 1 0 0 0 0
37 38 1 0 0 0 0
38 39 2 0 0 0 0
9 38 1 0 0 0 0
6 39 1 0 0 0 0
6 7 2 0 0 0 0
7 8 1 0 0 0 0
8 9 2 0 0 0 0
25 33 1 0 0 0 0
29 33 1 0 0 0 0
23 29 2 0 0 0 0
10 11 1 0 0 0 0
11 12 2 0 0 0 0
12 13 1 0 0 0 0
3 43 1 6 0 0 0
3 40 1 0 0 0 0
3 32 1 0 0 0 0
4 40 1 0 0 0 0
4 5 1 0 0 0 0
4 20 1 1 0 0 0
5 32 1 0 0 0 0
5 26 1 6 0 0 0
5 27 1 0 0 0 0
24 27 2 0 0 0 0
27 28 1 0 0 0 0
14 28 1 0 0 0 0
14 15 1 0 0 0 0
15 16 1 0 0 0 0
16 17 1 0 0 0 0
17 18 1 0 0 0 0
18 19 1 0 0 0 0
6 44 1 0 0 0 0
7 45 1 0 0 0 0
8 46 1 0 0 0 0
9 47 1 0 0 0 0
25 48 1 0 0 0 0
25 49 1 0 0 0 0
21 33 1 0 0 0 0
10 50 1 0 0 0 0
11 51 1 0 0 0 0
12 52 1 0 0 0 0
13 53 1 0 0 0 0
32 54 1 0 0 0 0
32 55 1 0 0 0 0
22 26 1 0 0 0 0
14 56 1 0 0 0 0
14 57 1 0 0 0 0
15 58 1 0 0 0 0
15 59 1 0 0 0 0
16 60 1 0 0 0 0
16 61 1 0 0 0 0
17 62 1 0 0 0 0
17 63 1 0 0 0 0
18 64 1 0 0 0 0
18 65 1 0 0 0 0
19 66 1 0 0 0 0
19 67 1 0 0 0 0
19 68 1 0 0 0 0
20 69 1 0 0 0 0
20 70 1 0 0 0 0
20 71 1 0 0 0 0
M END
$$$$
PubChem CID :
3844
more info or order :
company information

StressMarq Biosciences
PO Box 55036 CADBORO BAY
3825 Cadboro Bay Road
Victoria BC V8N 4G0
3825 Cadboro Bay Road
Victoria BC V8N 4G0
info@stressmarq.com
http://www.stressmarq.com1-250-294-9065
headquarters: canada
StressMarq Biosciences Inc. is a bioreagents company producing high-quality antibodies, antibody conjugates, proteins, assay kits, and small molecules for the life sciences.
With over 17,000 products, we offer a wide range of products for scientists in cancer, neuroscience, epigenetics, cell signalling, and cellular stress research areas.
Based in Victoria, BC, with a small but dedicated group of scientists, StressMarq provides highly-validated products that are sold with our quality guarantee, and supported by our years of scientific expertise. Our products are available in over 50 countries through our extensive distributor network.
StressMarq draws on scientific excellence from around the globe. We strive to partner with academic or for-profit institutions through licensing agreements to bring cutting-edge research tools to the scientific community.
With over 17,000 products, we offer a wide range of products for scientists in cancer, neuroscience, epigenetics, cell signalling, and cellular stress research areas.
Based in Victoria, BC, with a small but dedicated group of scientists, StressMarq provides highly-validated products that are sold with our quality guarantee, and supported by our years of scientific expertise. Our products are available in over 50 countries through our extensive distributor network.
StressMarq draws on scientific excellence from around the globe. We strive to partner with academic or for-profit institutions through licensing agreements to bring cutting-edge research tools to the scientific community.
browse more products
questions and comments
