product summary
Loading...
company name :
StressMarq Biosciences
product type :
chemical
product name :
Ponasterone A
catalog :
SIH-419-5MG
quantity :
5 mg
price :
194 USD
more info or order :
image
image 1 :

Chemical structure of Ponasterone A (SIH-419), a beta-galactosidase expression inducer. CAS #: 13408-56-5. Molecular Formula: C27H44O6. Molecular Weight: 464.6 g/mol.
product information
Catalog No :
SIH-419-5MG
Product Name :
Ponasterone A
Category :
Small Molecules
Product Type :
Inducer
Size :
5 mg
List Price USD :
194 USD
Description :
Ecdysteroid
Alternative Name(s) :
25-Deoxy-20-hydroxyecdysone, 25-Deoxyecdysterone, 2β,3β,14α,20R,22R-Pentahydroxy-5β-cholest-7-en-6-one
CAS No :
13408-56-5
MolecularFormula :
C27H44O6
Molecular Weight :
464.6
Source :
Isolated
Purity :
>99
SMILES :
[C@@]34(C2=CC([C@@H]1C[C@@H](O)[C@H](C[C@@]1([C@H]2CC[C@@]3([C@@H]([C@]([C@@H](CCC(C)C)O)(O)C)CC4)C)C)O)=O)O
InChI :
InChI=1S/C27H44O6/c1-15(2)6-7-23(31)26(5,32)22-9-11-27(33)17-12-19(28)18-13-20(29)21(30)14-24(18,3)16(17)8-10-25(22,27)4/h12,15-16,18,20-23,29-33H,6-11,13-14H2,1-5H3/t16-,18-,20+,21-,22-,23+,24+,25+,26+,27+/m0/s1
InChIKey :
PJYYBCXMCWDUAZ-JJJZTNILSA-N
SD File :
C27H44O6
APtclcactv04251417162D 0 0.00000 0.00000
77 80 0 0 1 0 0 0 0 0999 V2000
7.9174 -1.2250 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0
5.2754 -1.7318 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0
7.9174 -0.2250 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0
6.1854 -1.2250 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0
5.2674 -2.7734 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0
8.8637 0.0797 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0
9.1743 1.0303 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0
3.4007 -1.6957 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0
3.3923 -2.7807 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0
9.4850 1.9808 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0
10.4635 2.1870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7742 3.1375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2831 -0.7319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9174 0.7750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2238 1.3409 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0633 4.2943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4205 2.5994 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4544 -2.5350 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
10.5863 1.1337 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
2.0000 -1.4895 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
2.5220 -3.8973 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
9.0098 3.3144 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
6.1733 -4.2943 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.3486 -1.1678 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3319 -3.3232 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8637 -1.5297 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0514 0.2750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1854 -0.2250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4473 -0.7250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9174 -2.2250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.1248 0.7196 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5405 -1.1857 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5244 -3.2773 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.8171 2.7251 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.1694 -3.2943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7527 3.3437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0675 -2.7665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0514 -1.7250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7034 0.2116 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
5.2706 -3.6234 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
6.9215 -0.8000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
7.6080 -3.0703 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
4.7568 -0.7011 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
3.9586 -0.6857 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
3.9346 -3.7991 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
4.7329 -3.7961 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
8.6126 -2.0966 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
9.4010 -1.8390 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
7.4499 0.7499 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
6.6529 0.7499 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
5.9733 0.3576 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
5.5748 -0.3327 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
9.9081 -1.1397 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
9.9081 -0.3103 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
2.8608 -2.0005 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
2.8572 -2.4676 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
8.8783 1.8529 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
10.4841 1.5673 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
11.0773 2.0996 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
5.9031 -0.7367 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
5.2879 -0.1119 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
4.6631 -0.7271 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
8.5374 0.7750 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
7.9174 1.3950 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
7.2974 0.7750 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
10.7536 3.7572 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
10.1603 3.2249 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
8.4164 1.9302 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
7.6345 1.5335 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
8.0312 0.7516 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
11.5601 2.7544 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
12.6526 4.1016 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
12.2559 4.8836 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
11.4740 4.4869 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
11.9590 2.1854 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
12.8346 2.1380 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
12.8820 3.0135 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
1 38 1 0 0 0 0
2 4 1 0 0 0 0
1 3 1 0 0 0 0
4 38 1 0 0 0 0
37 38 2 0 0 0 0
5 35 1 0 0 0 0
3 6 1 0 0 0 0
35 37 1 0 0 0 0
6 7 1 0 0 0 0
2 24 1 0 0 0 0
5 25 1 0 0 0 0
1 26 1 0 0 0 0
27 28 1 0 0 0 0
4 28 1 0 0 0 0
26 29 1 0 0 0 0
8 24 1 0 0 0 0
9 25 1 0 0 0 0
23 35 2 0 0 0 0
7 10 1 0 0 0 0
1 30 1 6 0 0 0
10 11 1 0 0 0 0
7 31 1 1 0 0 0
2 13 1 1 0 0 0
3 14 1 1 0 0 0
8 32 1 1 0 0 0
9 33 1 1 0 0 0
11 12 1 0 0 0 0
7 15 1 0 0 0 0
10 34 1 6 0 0 0
12 36 1 0 0 0 0
16 36 1 0 0 0 0
17 36 1 0 0 0 0
6 39 1 6 0 0 0
5 40 1 1 0 0 0
4 41 1 6 0 0 0
2 5 1 0 0 0 0
3 27 1 0 0 0 0
6 29 1 0 0 0 0
8 9 1 0 0 0 0
37 42 1 0 0 0 0
24 43 1 0 0 0 0
24 44 1 0 0 0 0
25 45 1 0 0 0 0
25 46 1 0 0 0 0
26 47 1 0 0 0 0
26 48 1 0 0 0 0
27 49 1 0 0 0 0
27 50 1 0 0 0 0
28 51 1 0 0 0 0
28 52 1 0 0 0 0
29 53 1 0 0 0 0
29 54 1 0 0 0 0
8 55 1 0 0 0 0
9 56 1 0 0 0 0
10 57 1 0 0 0 0
18 30 1 0 0 0 0
11 58 1 0 0 0 0
11 59 1 0 0 0 0
19 31 1 0 0 0 0
13 60 1 0 0 0 0
13 61 1 0 0 0 0
13 62 1 0 0 0 0
14 63 1 0 0 0 0
14 64 1 0 0 0 0
14 65 1 0 0 0 0
20 32 1 0 0 0 0
21 33 1 0 0 0 0
12 66 1 0 0 0 0
12 67 1 0 0 0 0
15 68 1 0 0 0 0
15 69 1 0 0 0 0
15 70 1 0 0 0 0
22 34 1 0 0 0 0
36 71 1 0 0 0 0
16 72 1 0 0 0 0
16 73 1 0 0 0 0
16 74 1 0 0 0 0
17 75 1 0 0 0 0
17 76 1 0 0 0 0
17 77 1 0 0 0 0
M END
$$$$
PubChem CID :
115127
more info or order :
company information

StressMarq Biosciences
PO Box 55036 CADBORO BAY
3825 Cadboro Bay Road
Victoria BC V8N 4G0
3825 Cadboro Bay Road
Victoria BC V8N 4G0
info@stressmarq.com
http://www.stressmarq.com1-250-294-9065
headquarters: canada
StressMarq Biosciences Inc. is a bioreagents company producing high-quality antibodies, antibody conjugates, proteins, assay kits, and small molecules for the life sciences.
With over 17,000 products, we offer a wide range of products for scientists in cancer, neuroscience, epigenetics, cell signalling, and cellular stress research areas.
Based in Victoria, BC, with a small but dedicated group of scientists, StressMarq provides highly-validated products that are sold with our quality guarantee, and supported by our years of scientific expertise. Our products are available in over 50 countries through our extensive distributor network.
StressMarq draws on scientific excellence from around the globe. We strive to partner with academic or for-profit institutions through licensing agreements to bring cutting-edge research tools to the scientific community.
With over 17,000 products, we offer a wide range of products for scientists in cancer, neuroscience, epigenetics, cell signalling, and cellular stress research areas.
Based in Victoria, BC, with a small but dedicated group of scientists, StressMarq provides highly-validated products that are sold with our quality guarantee, and supported by our years of scientific expertise. Our products are available in over 50 countries through our extensive distributor network.
StressMarq draws on scientific excellence from around the globe. We strive to partner with academic or for-profit institutions through licensing agreements to bring cutting-edge research tools to the scientific community.
browse more products
questions and comments
