product summary
Loading...
company name :
StressMarq Biosciences
product type :
chemical
product name :
D-AP5
catalog :
SIH-411-5MG
quantity :
5 mg
price :
97 USD
image
image 1 :
StressMarq Biosciences SIH-411-5MG image 1
Chemical structure of D-AP5 (SIH-411), a Glutamate-NMDA receptor antagonist. CAS #: 79055-68-8. Molecular Formula: C5H12NO5P. Molecular Weight: 197.13 g/mol.
product information
Catalog No :
SIH-411-5MG
Product Name :
D-AP5
Category :
Small Molecules
Product Type :
Antagonist
Size :
5 mg
List Price USD :
97 USD
Description :
NMDA receptor antagonist
Alternative Name(s) :
D-amino-5-phosphonopentaoic acid
CAS No :
79055-68-8
MolecularFormula :
C5H12NO5P
Molecular Weight :
197.13
Source :
Synthetic
Purity :
>99.5
SMILES :
[C@@H]([NH3+])(CCC[P]([O-])([O-])=O)C([O-])=O
InChI :
InChI=1S/C5H12NO5P/c6-4(5(7)8)2-1-3-12(9,10)11/h4H,1-3,6H2,(H,7,8)(H2,9,10,11)/t4-/m1/s1
InChIKey :
VOROEQBFPPIACJ-SCSAIBSYSA-N
SD File :
C5H10NO5P APtclcactv04251416562D 0 0.00000 0.00000 22 21 0 0 1 0 0 0 0 0999 V2000 4.5981 1.1830 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 4.5981 0.1830 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.7321 -0.3170 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.7321 -1.3170 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3660 -0.9510 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.7321 2.6830 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.7321 1.6830 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.0010 1.9930 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 5.7741 1.1461 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 5.1541 2.2199 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0000 -2.3170 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0 3.3660 -2.6830 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0 2.8660 1.1830 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0 2.8660 -1.8170 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0 5.4641 1.6830 0.0000 N 0 3 0 0 0 0 0 0 0 0 0 0 4.8101 -0.3996 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2087 0.2907 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5200 0.2656 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1215 -0.4246 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5981 1.8030 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9441 -1.8996 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3426 -1.2093 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 11 14 1 0 0 0 0 12 14 1 0 0 0 0 5 14 2 0 0 0 0 4 14 1 0 0 0 0 7 13 1 0 0 0 0 6 7 2 0 0 0 0 1 15 1 6 0 0 0 8 15 1 0 0 0 0 9 15 1 0 0 0 0 10 15 1 0 0 0 0 2 3 1 0 0 0 0 1 2 1 0 0 0 0 2 16 1 0 0 0 0 2 17 1 0 0 0 0 3 4 1 0 0 0 0 3 18 1 0 0 0 0 3 19 1 0 0 0 0 1 7 1 0 0 0 0 1 20 1 0 0 0 0 4 21 1 0 0 0 0 4 22 1 0 0 0 0 M CHG 4 11 -1 12 -1 13 -1 15 1 M END $$$$
PubChem CID :
135342
company information
StressMarq Biosciences
PO Box 55036 CADBORO BAY
3825 Cadboro Bay Road
Victoria BC V8N 4G0
info@stressmarq.com
http://www.stressmarq.com
1-250-294-9065
headquarters: canada
StressMarq Biosciences Inc. is a bioreagents company producing high-quality antibodies, antibody conjugates, proteins, assay kits, and small molecules for the life sciences.
With over 17,000 products, we offer a wide range of products for scientists in cancer, neuroscience, epigenetics, cell signalling, and cellular stress research areas.
Based in Victoria, BC, with a small but dedicated group of scientists, StressMarq provides highly-validated products that are sold with our quality guarantee, and supported by our years of scientific expertise. Our products are available in over 50 countries through our extensive distributor network.
StressMarq draws on scientific excellence from around the globe. We strive to partner with academic or for-profit institutions through licensing agreements to bring cutting-edge research tools to the scientific community.